C23H24ClN5O4 — CID 135452363
N-[N-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 135452363) has the molecular formula C23H24ClN5O4 and a molecular weight of 469.93 g/mol. Its IUPAC name is N-[N-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[N-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135452363 |
| Molecular Formula | C23H24ClN5O4 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[N-(3-chlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=Nc2nc(C)cc(C)n2)Nc2cccc(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24ClN5O4/c1-13-9-14(2)26-22(25-13)29-23(27-17-8-6-7-16(24)12-17)28-21(30)15-10-18(31-3)20(33-5)19(11-15)32-4/h6-12H,1-5H3,(H2,25,26,27,28,29,30) |
| InChIKey | DPMPMHUQWYLZPY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|