C17H17ClN2O5 — CID 108987070
N-(3-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide (PubChem CID 108987070) has the molecular formula C17H17ClN2O5 and a molecular weight of 364.79 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide.
| Compound Name | N-(3-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108987070 |
| Molecular Formula | C17H17ClN2O5 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | N-(3-chlorophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2cccc(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17ClN2O5/c1-23-13-8-12(9-14(24-2)15(13)25-3)20-17(22)16(21)19-11-6-4-5-10(18)7-11/h4-9H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | AYYCCQGOTBZXDH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|