C19H21N3O6 — CID 108987482
N-(3-acetamidophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide (PubChem CID 108987482) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide.
| Compound Name | N-(3-acetamidophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108987482 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-(3-acetamidophenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2cccc(NC(C)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O6/c1-11(23)20-12-6-5-7-13(8-12)21-18(24)19(25)22-14-9-15(26-2)17(28-4)16(10-14)27-3/h5-10H,1-4H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | RPKBCSSQAGBFMC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|