C23H20ClN7O — CID 135609969
1-(4-chlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-quinolin-3-ylcarbamimidoyl]urea (PubChem CID 135609969) has the molecular formula C23H20ClN7O and a molecular weight of 445.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-quinolin-3-ylcarbamimidoyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-quinolin-3-ylcarbamimidoyl]urea |
|---|---|
| PubChem CID | 135609969 |
| Molecular Formula | C23H20ClN7O |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-quinolin-3-ylcarbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(/N=C(/NC(=O)Nc2ccc(Cl)cc2)Nc2cnc3ccccc3c2)n1 |
| InChI | InChI=1S/C23H20ClN7O/c1-14-11-15(2)27-21(26-14)30-22(31-23(32)29-18-9-7-17(24)8-10-18)28-19-12-16-5-3-4-6-20(16)25-13-19/h3-13H,1-2H3,(H3,26,27,28,29,30,31,32) |
| InChIKey | HPAPCMBUWMZWPQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|