C16H11Cl2N3O — CID 2239305
1-(3,4-dichlorophenyl)-3-quinolin-3-ylurea (PubChem CID 2239305) has the molecular formula C16H11Cl2N3O and a molecular weight of 332.19 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-quinolin-3-ylurea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-quinolin-3-ylurea |
|---|---|
| PubChem CID | 2239305 |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-quinolin-3-ylurea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C16H11Cl2N3O/c17-13-6-5-11(8-14(13)18)20-16(22)21-12-7-10-3-1-2-4-15(10)19-9-12/h1-9H,(H2,20,21,22) |
| InChIKey | OYDJTCXSXYTRLW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |