C23H15ClF2N6O3 — CID 42602382
N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-2-fluoro-5-nitrobenzamide (PubChem CID 42602382) has the molecular formula C23H15ClF2N6O3 and a molecular weight of 496.86 g/mol. Its IUPAC name is N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-2-fluoro-5-nitrobenzamide.
| Compound Name | N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-2-fluoro-5-nitrobenzamide |
|---|---|
| PubChem CID | 42602382 |
| Molecular Formula | C23H15ClF2N6O3 |
| Molecular Weight | 496.86 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]-2-fluoro-5-nitrobenzamide |
| SMILES | O=C(Nc1cccc(Nc2cc(Nc3ccc(F)c(Cl)c3)ncn2)c1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C23H15ClF2N6O3/c24-18-9-15(4-6-20(18)26)30-22-11-21(27-12-28-22)29-13-2-1-3-14(8-13)31-23(33)17-10-16(32(34)35)5-7-19(17)25/h1-12H,(H,31,33)(H2,27,28,29,30) |
| InChIKey | UJNVWNGECKSZGN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.86 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|