C19H16Cl2FN5O — CID 42602539
2-chloro-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]propanamide (PubChem CID 42602539) has the molecular formula C19H16Cl2FN5O and a molecular weight of 420.28 g/mol. Its IUPAC name is 2-chloro-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]propanamide.
| Compound Name | 2-chloro-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 42602539 |
| Molecular Formula | C19H16Cl2FN5O |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-chloro-N-[3-[[6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]amino]phenyl]propanamide |
| SMILES | CC(Cl)C(=O)Nc1cccc(Nc2cc(Nc3ccc(F)c(Cl)c3)ncn2)c1 |
| InChI | InChI=1S/C19H16Cl2FN5O/c1-11(20)19(28)27-13-4-2-3-12(7-13)25-17-9-18(24-10-23-17)26-14-5-6-16(22)15(21)8-14/h2-11H,1H3,(H,27,28)(H2,23,24,25,26) |
| InChIKey | WZLXEYGXFTZLCU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|