C17H21ClN6O2 — CID 17090040
1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]urea (PubChem CID 17090040) has the molecular formula C17H21ClN6O2 and a molecular weight of 376.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 17090040 |
| Molecular Formula | C17H21ClN6O2 |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]urea |
| SMILES | COCC/N=C(\NC(=O)Nc1cccc(Cl)c1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C17H21ClN6O2/c1-11-9-12(2)21-16(20-11)23-15(19-7-8-26-3)24-17(25)22-14-6-4-5-13(18)10-14/h4-6,9-10H,7-8H2,1-3H3,(H3,19,20,21,22,23,24,25) |
| InChIKey | JZGRZERDVXHSJK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|