C18H23ClN6O3 — CID 17088922
1-(3-chlorophenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea (PubChem CID 17088922) has the molecular formula C18H23ClN6O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 17088922 |
| Molecular Formula | C18H23ClN6O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea |
| SMILES | COC(C/N=C(\NC(=O)Nc1cccc(Cl)c1)Nc1nc(C)cc(C)n1)OC |
| InChI | InChI=1S/C18H23ClN6O3/c1-11-8-12(2)22-17(21-11)24-16(20-10-15(27-3)28-4)25-18(26)23-14-7-5-6-13(19)9-14/h5-9,15H,10H2,1-4H3,(H3,20,21,22,23,24,25,26) |
| InChIKey | RDVHNHPMWHEQQZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|