C17H28N6O2S — CID 17088910
1-cyclopentyl-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea (PubChem CID 17088910) has the molecular formula C17H28N6O2S and a molecular weight of 380.52 g/mol. Its IUPAC name is 1-cyclopentyl-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17088910 |
| Molecular Formula | C17H28N6O2S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-cyclopentyl-3-[N'-(2,2-dimethoxyethyl)-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]thiourea |
| SMILES | COC(C/N=C(\NC(=S)NC1CCCC1)Nc1nc(C)cc(C)n1)OC |
| InChI | InChI=1S/C17H28N6O2S/c1-11-9-12(2)20-16(19-11)22-15(18-10-14(24-3)25-4)23-17(26)21-13-7-5-6-8-13/h9,13-14H,5-8,10H2,1-4H3,(H3,18,19,20,21,22,23,26) |
| InChIKey | ZLKGJLIVLPOAKA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|