C21H28N6S — CID 17089478
1-cyclopentyl-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea (PubChem CID 17089478) has the molecular formula C21H28N6S and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-cyclopentyl-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089478 |
| Molecular Formula | C21H28N6S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-cyclopentyl-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-phenylethyl)carbamimidoyl]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2ccccc2)NC(=S)NC2CCCC2)n1 |
| InChI | InChI=1S/C21H28N6S/c1-15-14-16(2)24-20(23-15)26-19(22-13-12-17-8-4-3-5-9-17)27-21(28)25-18-10-6-7-11-18/h3-5,8-9,14,18H,6-7,10-13H2,1-2H3,(H3,22,23,24,25,26,27,28) |
| InChIKey | TVUVAIYYBACMOK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|