C20H28N6S — CID 17089072
1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methylpropyl)carbamimidoyl]thiourea (PubChem CID 17089072) has the molecular formula C20H28N6S and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methylpropyl)carbamimidoyl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methylpropyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089072 |
| Molecular Formula | C20H28N6S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methylpropyl)carbamimidoyl]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CC(C)C)NC(=S)Nc2cccc(C)c2C)n1 |
| InChI | InChI=1S/C20H28N6S/c1-12(2)11-21-18(25-19-22-14(4)10-15(5)23-19)26-20(27)24-17-9-7-8-13(3)16(17)6/h7-10,12H,11H2,1-6H3,(H3,21,22,23,24,25,26,27) |
| InChIKey | UNEWDUXLBUTHDB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|