C20H28N6OS — CID 17090064
1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea (PubChem CID 17090064) has the molecular formula C20H28N6OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17090064 |
| Molecular Formula | C20H28N6OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-methoxypropyl)carbamimidoyl]thiourea |
| SMILES | COCCC/N=C(\NC(=S)Nc1cccc(C)c1C)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C20H28N6OS/c1-13-8-6-9-17(16(13)4)24-20(28)26-18(21-10-7-11-27-5)25-19-22-14(2)12-15(3)23-19/h6,8-9,12H,7,10-11H2,1-5H3,(H3,21,22,23,24,25,26,28) |
| InChIKey | NWDOBWJCOZHHAV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|