C22H31N7OS — CID 17089960
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(2-methylphenyl)thiourea (PubChem CID 17089960) has the molecular formula C22H31N7OS and a molecular weight of 441.61 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 17089960 |
| Molecular Formula | C22H31N7OS |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCCN2CCOCC2)NC(=S)Nc2ccccc2C)n1 |
| InChI | InChI=1S/C22H31N7OS/c1-16-7-4-5-8-19(16)26-22(31)28-20(27-21-24-17(2)15-18(3)25-21)23-9-6-10-29-11-13-30-14-12-29/h4-5,7-8,15H,6,9-14H2,1-3H3,(H3,23,24,25,26,27,28,31) |
| InChIKey | ZPLDGZOULKWDSI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|