C23H33N7OS — CID 17089932
1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]thiourea (PubChem CID 17089932) has the molecular formula C23H33N7OS and a molecular weight of 455.63 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17089932 |
| Molecular Formula | C23H33N7OS |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)N/C(=N\CCCN2CCOCC2)Nc2nc(C)cc(C)n2)c1 |
| InChI | InChI=1S/C23H33N7OS/c1-16-12-17(2)14-20(13-16)27-23(32)29-21(28-22-25-18(3)15-19(4)26-22)24-6-5-7-30-8-10-31-11-9-30/h12-15H,5-11H2,1-4H3,(H3,24,25,26,27,28,29,32) |
| InChIKey | FRKUQBFXSXLNGL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|