C23H30N8S2 — CID 17090251
1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea (PubChem CID 17090251) has the molecular formula C23H30N8S2 and a molecular weight of 482.68 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea |
|---|---|
| PubChem CID | 17090251 |
| Molecular Formula | C23H30N8S2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)N/C(=N\CCSCc2nc[nH]c2C)Nc2nc(C)cc(C)n2)c1 |
| InChI | InChI=1S/C23H30N8S2/c1-14-8-15(2)10-19(9-14)29-23(32)31-21(30-22-27-16(3)11-17(4)28-22)24-6-7-33-12-20-18(5)25-13-26-20/h8-11,13H,6-7,12H2,1-5H3,(H,25,26)(H3,24,27,28,29,30,31,32) |
| InChIKey | WSNSLZYSMQDVPC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|