C20H26N8OS2 — CID 17090274
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 17090274) has the molecular formula C20H26N8OS2 and a molecular weight of 458.62 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17090274 |
| Molecular Formula | C20H26N8OS2 |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCSCc2nc[nH]c2C)NC(=S)NCc2ccco2)n1 |
| InChI | InChI=1S/C20H26N8OS2/c1-13-9-14(2)26-19(25-13)27-18(28-20(30)22-10-16-5-4-7-29-16)21-6-8-31-11-17-15(3)23-12-24-17/h4-5,7,9,12H,6,8,10-11H2,1-3H3,(H,23,24)(H3,21,22,25,26,27,28,30) |
| InChIKey | VOAUQNMTOJGLSI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|