C23H31N7O3S — CID 17089947
methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]carbamothioylamino]benzoate (PubChem CID 17089947) has the molecular formula C23H31N7O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]carbamothioylamino]benzoate.
| Compound Name | methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17089947 |
| Molecular Formula | C23H31N7O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | methyl 4-[[N-(4,6-dimethylpyrimidin-2-yl)-N'-(3-morpholin-4-ylpropyl)carbamimidoyl]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)N/C(=N\CCCN2CCOCC2)Nc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C23H31N7O3S/c1-16-15-17(2)26-22(25-16)28-21(24-9-4-10-30-11-13-33-14-12-30)29-23(34)27-19-7-5-18(6-8-19)20(31)32-3/h5-8,15H,4,9-14H2,1-3H3,(H3,24,25,26,27,28,29,34) |
| InChIKey | YRYLKCMHJLGPBB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|