C18H21F3N6O2S — CID 17090042
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]-3-[3-(trifluoromethoxy)phenyl]thiourea (PubChem CID 17090042) has the molecular formula C18H21F3N6O2S and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]-3-[3-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]-3-[3-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 17090042 |
| Molecular Formula | C18H21F3N6O2S |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2-methoxyethyl)carbamimidoyl]-3-[3-(trifluoromethoxy)phenyl]thiourea |
| SMILES | COCC/N=C(\NC(=S)Nc1cccc(OC(F)(F)F)c1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C18H21F3N6O2S/c1-11-9-12(2)24-16(23-11)26-15(22-7-8-28-3)27-17(30)25-13-5-4-6-14(10-13)29-18(19,20)21/h4-6,9-10H,7-8H2,1-3H3,(H3,22,23,24,25,26,27,30) |
| InChIKey | ULRPEFQHKZHLED-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|