C15H24N6S — CID 2960768
1-[N'-cyclopentyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-ethylthiourea (PubChem CID 2960768) has the molecular formula C15H24N6S and a molecular weight of 320.47 g/mol. Its IUPAC name is 1-[N'-cyclopentyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-ethylthiourea.
| Compound Name | 1-[N'-cyclopentyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 2960768 |
| Molecular Formula | C15H24N6S |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[N'-cyclopentyl-N-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-3-ethylthiourea |
| SMILES | CCNC(=S)N/C(=N\C1CCCC1)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C15H24N6S/c1-4-16-15(22)21-14(19-12-7-5-6-8-12)20-13-17-10(2)9-11(3)18-13/h9,12H,4-8H2,1-3H3,(H3,16,17,18,19,20,21,22) |
| InChIKey | QKIQJXSEZBTOEQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|