C26H39N7O3S — CID 17089828
1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 17089828) has the molecular formula C26H39N7O3S and a molecular weight of 529.71 g/mol. Its IUPAC name is 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17089828 |
| Molecular Formula | C26H39N7O3S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | 1-[N-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)N/C(=N\C2CC(C)(C)NC(C)(C)C2)Nc2nc(C)cc(C)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H39N7O3S/c1-15-10-16(2)28-22(27-15)31-23(29-18-13-25(3,4)33-26(5,6)14-18)32-24(37)30-17-11-19(34-7)21(36-9)20(12-17)35-8/h10-12,18,33H,13-14H2,1-9H3,(H3,27,28,29,30,31,32,37) |
| InChIKey | IOAVXQKMVZZKOS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|