C24H33N7O5S — CID 21383528
ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(3,4,5-trimethoxyphenyl)carbamothioyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 21383528) has the molecular formula C24H33N7O5S and a molecular weight of 531.64 g/mol. Its IUPAC name is ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(3,4,5-trimethoxyphenyl)carbamothioyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(3,4,5-trimethoxyphenyl)carbamothioyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21383528 |
| Molecular Formula | C24H33N7O5S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | ethyl 4-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-N'-[(3,4,5-trimethoxyphenyl)carbamothioyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N\C(=S)Nc2cc(OC)c(OC)c(OC)c2)Nc2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C24H33N7O5S/c1-7-36-24(32)31-10-8-30(9-11-31)22(28-21-25-15(2)12-16(3)26-21)29-23(37)27-17-13-18(33-4)20(35-6)19(14-17)34-5/h12-14H,7-11H2,1-6H3,(H2,25,26,27,28,29,37) |
| InChIKey | OZYKRDWPBRFIBP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|