C33H35F2N7S — CID 17078515
(1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 17078515) has the molecular formula C33H35F2N7S and a molecular weight of 599.76 g/mol. Its IUPAC name is (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 17078515 |
| Molecular Formula | C33H35F2N7S |
| Molecular Weight | 599.76 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C33H35F2N7S/c1-21-17-22(2)19-29(18-21)38-33(43)40-32(39-31-36-23(3)20-24(4)37-31)42-15-13-41(14-16-42)30(25-5-9-27(34)10-6-25)26-7-11-28(35)12-8-26/h5-12,17-20,30H,13-16H2,1-4H3,(H2,36,37,38,39,40,43) |
| InChIKey | RPWGRSHHBALWCS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.76 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|