C33H37N7S — CID 17090896
(1Z)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 17090896) has the molecular formula C33H37N7S and a molecular weight of 563.78 g/mol. Its IUPAC name is (1Z)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | (1Z)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 17090896 |
| Molecular Formula | C33H37N7S |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | (1Z)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2cccc(C)c2C)N2CCN(C(c3ccccc3)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C33H37N7S/c1-23-12-11-17-29(26(23)4)36-33(41)38-32(37-31-34-24(2)22-25(3)35-31)40-20-18-39(19-21-40)30(27-13-7-5-8-14-27)28-15-9-6-10-16-28/h5-17,22,30H,18-21H2,1-4H3,(H2,34,35,36,37,38,41) |
| InChIKey | FGAZWVGLJJKNCF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|