C27H30N8S2 — CID 17078580
(1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 17078580) has the molecular formula C27H30N8S2 and a molecular weight of 530.73 g/mol. Its IUPAC name is (1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | (1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 17078580 |
| Molecular Formula | C27H30N8S2 |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2cccc(C)c2C)N2CCN(c3nsc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C27H30N8S2/c1-17-8-7-10-22(20(17)4)30-27(36)32-26(31-25-28-18(2)16-19(3)29-25)35-14-12-34(13-15-35)24-21-9-5-6-11-23(21)37-33-24/h5-11,16H,12-15H2,1-4H3,(H2,28,29,30,31,32,36) |
| InChIKey | PEMFHNQZXWHNFM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|