C19H24ClN7S — CID 17090404
(1Z)-1-[[4-(3-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-methylthiourea (PubChem CID 17090404) has the molecular formula C19H24ClN7S and a molecular weight of 417.97 g/mol. Its IUPAC name is (1Z)-1-[[4-(3-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-methylthiourea.
| Compound Name | (1Z)-1-[[4-(3-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-methylthiourea |
|---|---|
| PubChem CID | 17090404 |
| Molecular Formula | C19H24ClN7S |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (1Z)-1-[[4-(3-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-methylthiourea |
| SMILES | CNC(=S)/N=C(/Nc1nc(C)cc(C)n1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H24ClN7S/c1-13-11-14(2)23-17(22-13)24-18(25-19(28)21-3)27-9-7-26(8-10-27)16-6-4-5-15(20)12-16/h4-6,11-12H,7-10H2,1-3H3,(H2,21,22,23,24,25,28) |
| InChIKey | DVWLTMYQGXONMI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|