C26H31N7O2S — CID 17090802
(3Z)-1-(2,4-dimethoxyphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-phenylpiperazin-1-yl)methylidene]thiourea (PubChem CID 17090802) has the molecular formula C26H31N7O2S and a molecular weight of 505.65 g/mol. Its IUPAC name is (3Z)-1-(2,4-dimethoxyphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-phenylpiperazin-1-yl)methylidene]thiourea.
| Compound Name | (3Z)-1-(2,4-dimethoxyphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-phenylpiperazin-1-yl)methylidene]thiourea |
|---|---|
| PubChem CID | 17090802 |
| Molecular Formula | C26H31N7O2S |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (3Z)-1-(2,4-dimethoxyphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-phenylpiperazin-1-yl)methylidene]thiourea |
| SMILES | COc1ccc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H31N7O2S/c1-18-16-19(2)28-24(27-18)30-25(33-14-12-32(13-15-33)20-8-6-5-7-9-20)31-26(36)29-22-11-10-21(34-3)17-23(22)35-4/h5-11,16-17H,12-15H2,1-4H3,(H2,27,28,29,30,31,36) |
| InChIKey | SCCLAQSMROAPAM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|