C28H29N9OS — CID 17090723
(1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]-3-(4-phenoxyphenyl)thiourea (PubChem CID 17090723) has the molecular formula C28H29N9OS and a molecular weight of 539.67 g/mol. Its IUPAC name is (1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | (1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17090723 |
| Molecular Formula | C28H29N9OS |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]-3-(4-phenoxyphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2ccc(Oc3ccccc3)cc2)N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C28H29N9OS/c1-20-19-21(2)32-25(31-20)34-27(37-17-15-36(16-18-37)26-29-13-6-14-30-26)35-28(39)33-22-9-11-24(12-10-22)38-23-7-4-3-5-8-23/h3-14,19H,15-18H2,1-2H3,(H2,31,32,33,34,35,39) |
| InChIKey | NAJHPJHXGQLVMX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|