C27H33N7S — CID 17090336
(1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 17090336) has the molecular formula C27H33N7S and a molecular weight of 487.68 g/mol. Its IUPAC name is (1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | (1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 17090336 |
| Molecular Formula | C27H33N7S |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H33N7S/c1-19-14-20(2)16-24(15-19)30-27(35)32-26(31-25-28-21(3)17-22(4)29-25)34-12-10-33(11-13-34)18-23-8-6-5-7-9-23/h5-9,14-17H,10-13,18H2,1-4H3,(H2,28,29,30,31,32,35) |
| InChIKey | CTJOLMHTODMWGY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|