C26H30ClN7S — CID 17090341
(1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-chloro-4-methylphenyl)thiourea (PubChem CID 17090341) has the molecular formula C26H30ClN7S and a molecular weight of 508.10 g/mol. Its IUPAC name is (1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-chloro-4-methylphenyl)thiourea.
| Compound Name | (1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-chloro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 17090341 |
| Molecular Formula | C26H30ClN7S |
| Molecular Weight | 508.10 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | (1Z)-1-[(4-benzylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-chloro-4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(Cc3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C26H30ClN7S/c1-18-9-10-23(22(27)15-18)30-26(35)32-25(31-24-28-19(2)16-20(3)29-24)34-13-11-33(12-14-34)17-21-7-5-4-6-8-21/h4-10,15-16H,11-14,17H2,1-3H3,(H2,28,29,30,31,32,35) |
| InChIKey | NEDUKJKYQVVBFV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.10 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|