C25H28ClN7OS — CID 17091092
(3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea (PubChem CID 17091092) has the molecular formula C25H28ClN7OS and a molecular weight of 510.07 g/mol. Its IUPAC name is (3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea.
| Compound Name | (3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 17091092 |
| Molecular Formula | C25H28ClN7OS |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea |
| SMILES | COc1ccc(N2CCN(/C(=N\C(=S)Nc3ccccc3Cl)Nc3nc(C)cc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C25H28ClN7OS/c1-17-16-18(2)28-23(27-17)30-24(31-25(35)29-22-7-5-4-6-21(22)26)33-14-12-32(13-15-33)19-8-10-20(34-3)11-9-19/h4-11,16H,12-15H2,1-3H3,(H2,27,28,29,30,31,35) |
| InChIKey | IWYAQJLNGJLRKG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|