C32H33F2N7OS — CID 17091178
(1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-methoxyphenyl)thiourea (PubChem CID 17091178) has the molecular formula C32H33F2N7OS and a molecular weight of 601.73 g/mol. Its IUPAC name is (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-methoxyphenyl)thiourea.
| Compound Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17091178 |
| Molecular Formula | C32H33F2N7OS |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)/N=C(/Nc1nc(C)cc(C)n1)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H33F2N7OS/c1-21-20-22(2)36-30(35-21)38-31(39-32(43)37-27-6-4-5-7-28(27)42-3)41-18-16-40(17-19-41)29(23-8-12-25(33)13-9-23)24-10-14-26(34)15-11-24/h4-15,20,29H,16-19H2,1-3H3,(H2,35,36,37,38,39,43) |
| InChIKey | OBLXWCAIOYZDOF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|