C25H28N6O2S — CID 17090510
(1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea (PubChem CID 17090510) has the molecular formula C25H28N6O2S and a molecular weight of 476.61 g/mol. Its IUPAC name is (1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea.
| Compound Name | (1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17090510 |
| Molecular Formula | C25H28N6O2S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCc3ccccc3C2)c(OC)c1 |
| InChI | InChI=1S/C25H28N6O2S/c1-16-13-17(2)27-23(26-16)29-24(31-12-11-18-7-5-6-8-19(18)15-31)30-25(34)28-21-10-9-20(32-3)14-22(21)33-4/h5-10,13-14H,11-12,15H2,1-4H3,(H2,26,27,28,29,30,34) |
| InChIKey | CDNPFOPPUICTLE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|