C20H24N6S — CID 17090526
(3Z)-1-cyclopropyl-3-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea (PubChem CID 17090526) has the molecular formula C20H24N6S and a molecular weight of 380.52 g/mol. Its IUPAC name is (3Z)-1-cyclopropyl-3-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea.
| Compound Name | (3Z)-1-cyclopropyl-3-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
|---|---|
| PubChem CID | 17090526 |
| Molecular Formula | C20H24N6S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (3Z)-1-cyclopropyl-3-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)NC2CC2)N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C20H24N6S/c1-13-11-14(2)22-18(21-13)24-19(25-20(27)23-17-7-8-17)26-10-9-15-5-3-4-6-16(15)12-26/h3-6,11,17H,7-10,12H2,1-2H3,(H2,21,22,23,24,25,27) |
| InChIKey | GVHHKXCBXCVQOX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|