C24H33N7OS — CID 17090541
(1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 17090541) has the molecular formula C24H33N7OS and a molecular weight of 467.64 g/mol. Its IUPAC name is (1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | (1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 17090541 |
| Molecular Formula | C24H33N7OS |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | (1Z)-1-[3,4-dihydro-1H-isoquinolin-2-yl-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)NCCCN2CCOCC2)N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C24H33N7OS/c1-18-16-19(2)27-22(26-18)28-23(31-11-8-20-6-3-4-7-21(20)17-31)29-24(33)25-9-5-10-30-12-14-32-15-13-30/h3-4,6-7,16H,5,8-15,17H2,1-2H3,(H2,25,26,27,28,29,33) |
| InChIKey | NRLSSPNJWXYJDR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|