C32H42N8OS — CID 21383449
(1E)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 21383449) has the molecular formula C32H42N8OS and a molecular weight of 586.81 g/mol. Its IUPAC name is (1E)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | (1E)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 21383449 |
| Molecular Formula | C32H42N8OS |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | (1E)-1-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N\C(=S)NCCCN2CCOCC2)N2CCN(C(c3ccccc3)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C32H42N8OS/c1-25-24-26(2)35-30(34-25)36-31(37-32(42)33-14-9-15-38-20-22-41-23-21-38)40-18-16-39(17-19-40)29(27-10-5-3-6-11-27)28-12-7-4-8-13-28/h3-8,10-13,24,29H,9,14-23H2,1-2H3,(H2,33,34,35,36,37,42) |
| InChIKey | FDWCIYSJBRZEMR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|