C30H35F2N7OS — CID 21383498
(1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 21383498) has the molecular formula C30H35F2N7OS and a molecular weight of 579.72 g/mol. Its IUPAC name is (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 21383498 |
| Molecular Formula | C30H35F2N7OS |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)NCC2CCCO2)N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C30H35F2N7OS/c1-20-18-21(2)35-28(34-20)36-29(37-30(41)33-19-26-4-3-17-40-26)39-15-13-38(14-16-39)27(22-5-9-24(31)10-6-22)23-7-11-25(32)12-8-23/h5-12,18,26-27H,3-4,13-17,19H2,1-2H3,(H2,33,34,35,36,37,41) |
| InChIKey | LUZXDUHVUQERDY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|