C20H25FN6S — CID 21383370
(1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(3-methylpiperidin-1-yl)methylidene]-3-(4-fluorophenyl)thiourea (PubChem CID 21383370) has the molecular formula C20H25FN6S and a molecular weight of 400.53 g/mol. Its IUPAC name is (1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(3-methylpiperidin-1-yl)methylidene]-3-(4-fluorophenyl)thiourea.
| Compound Name | (1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(3-methylpiperidin-1-yl)methylidene]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 21383370 |
| Molecular Formula | C20H25FN6S |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (1Z)-1-[[(4,6-dimethylpyrimidin-2-yl)amino]-(3-methylpiperidin-1-yl)methylidene]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2ccc(F)cc2)N2CCCC(C)C2)n1 |
| InChI | InChI=1S/C20H25FN6S/c1-13-5-4-10-27(12-13)19(25-18-22-14(2)11-15(3)23-18)26-20(28)24-17-8-6-16(21)7-9-17/h6-9,11,13H,4-5,10,12H2,1-3H3,(H2,22,23,24,25,26,28) |
| InChIKey | HAZLSPOZTRJUBC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|