C27H31F2N7S — CID 17078541
(1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea (PubChem CID 17078541) has the molecular formula C27H31F2N7S and a molecular weight of 523.66 g/mol. Its IUPAC name is (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea.
| Compound Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea |
|---|---|
| PubChem CID | 17078541 |
| Molecular Formula | C27H31F2N7S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | (1Z)-1-[[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-ethylthiourea |
| SMILES | CCNC(=S)/N=C(/Nc1nc(C)cc(C)n1)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H31F2N7S/c1-4-30-27(37)34-26(33-25-31-18(2)17-19(3)32-25)36-15-13-35(14-16-36)24(20-5-9-22(28)10-6-20)21-7-11-23(29)12-8-21/h5-12,17,24H,4,13-16H2,1-3H3,(H2,30,31,32,33,34,37) |
| InChIKey | KITGBIHQXKZWNV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|