C33H35N7OS — CID 17090899
(3Z)-1-(4-acetylphenyl)-3-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea (PubChem CID 17090899) has the molecular formula C33H35N7OS and a molecular weight of 577.76 g/mol. Its IUPAC name is (3Z)-1-(4-acetylphenyl)-3-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea.
| Compound Name | (3Z)-1-(4-acetylphenyl)-3-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
|---|---|
| PubChem CID | 17090899 |
| Molecular Formula | C33H35N7OS |
| Molecular Weight | 577.76 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | (3Z)-1-(4-acetylphenyl)-3-[(4-benzhydrylpiperazin-1-yl)-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C33H35N7OS/c1-23-22-24(2)35-31(34-23)37-32(38-33(42)36-29-16-14-26(15-17-29)25(3)41)40-20-18-39(19-21-40)30(27-10-6-4-7-11-27)28-12-8-5-9-13-28/h4-17,22,30H,18-21H2,1-3H3,(H2,34,35,36,37,38,42) |
| InChIKey | QHQIMSXBNUTEID-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.76 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|