C27H31N7O2S — CID 17091109
(3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea (PubChem CID 17091109) has the molecular formula C27H31N7O2S and a molecular weight of 517.66 g/mol. Its IUPAC name is (3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea.
| Compound Name | (3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 17091109 |
| Molecular Formula | C27H31N7O2S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | (3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-methoxyphenyl)piperazin-1-yl]methylidene]thiourea |
| SMILES | COc1ccc(N2CCN(/C(=N\C(=S)Nc3ccc(C(C)=O)cc3)Nc3nc(C)cc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C27H31N7O2S/c1-18-17-19(2)29-25(28-18)31-26(32-27(37)30-22-7-5-21(6-8-22)20(3)35)34-15-13-33(14-16-34)23-9-11-24(36-4)12-10-23/h5-12,17H,13-16H2,1-4H3,(H2,28,29,30,31,32,37) |
| InChIKey | JRPWLXVDTVBMLG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|