C27H32ClN7O3S — CID 17091140
(1E)-1-[[4-(4-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 17091140) has the molecular formula C27H32ClN7O3S and a molecular weight of 570.12 g/mol. Its IUPAC name is (1E)-1-[[4-(4-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | (1E)-1-[[4-(4-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17091140 |
| Molecular Formula | C27H32ClN7O3S |
| Molecular Weight | 570.12 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | (1E)-1-[[4-(4-chlorophenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)/N=C(\Nc2nc(C)cc(C)n2)N2CCN(c3ccc(Cl)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C27H32ClN7O3S/c1-17-14-18(2)30-25(29-17)32-26(35-12-10-34(11-13-35)21-8-6-19(28)7-9-21)33-27(39)31-20-15-22(36-3)24(38-5)23(16-20)37-4/h6-9,14-16H,10-13H2,1-5H3,(H2,29,30,31,32,33,39) |
| InChIKey | LFUMHHLZVFWLMN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|