C27H32ClN7O2S — CID 17090676
(1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea (PubChem CID 17090676) has the molecular formula C27H32ClN7O2S and a molecular weight of 554.12 g/mol. Its IUPAC name is (1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea.
| Compound Name | (1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17090676 |
| Molecular Formula | C27H32ClN7O2S |
| Molecular Weight | 554.12 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | (1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(2,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(c3cc(Cl)ccc3C)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H32ClN7O2S/c1-17-6-7-20(28)15-23(17)34-10-12-35(13-11-34)26(32-25-29-18(2)14-19(3)30-25)33-27(38)31-22-9-8-21(36-4)16-24(22)37-5/h6-9,14-16H,10-13H2,1-5H3,(H2,29,30,31,32,33,38) |
| InChIKey | HCIUYWMAUJSKCQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.12 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|