C31H32ClN7OS — CID 17090681
(1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea (PubChem CID 17090681) has the molecular formula C31H32ClN7OS and a molecular weight of 586.17 g/mol. Its IUPAC name is (1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | (1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17090681 |
| Molecular Formula | C31H32ClN7OS |
| Molecular Weight | 586.17 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | (1Z)-1-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2ccc(Oc3ccccc3)cc2)N2CCN(c3cc(Cl)ccc3C)CC2)n1 |
| InChI | InChI=1S/C31H32ClN7OS/c1-21-9-10-24(32)20-28(21)38-15-17-39(18-16-38)30(36-29-33-22(2)19-23(3)34-29)37-31(41)35-25-11-13-27(14-12-25)40-26-7-5-4-6-8-26/h4-14,19-20H,15-18H2,1-3H3,(H2,33,34,35,36,37,41) |
| InChIKey | IKOGZLSXUREZNV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.17 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|