C24H27N9O2S — CID 17090727
methyl 4-[[(Z)-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]carbamothioyl]amino]benzoate (PubChem CID 17090727) has the molecular formula C24H27N9O2S and a molecular weight of 505.61 g/mol. Its IUPAC name is methyl 4-[[(Z)-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]carbamothioyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 17090727 |
| Molecular Formula | C24H27N9O2S |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | methyl 4-[[(Z)-[[(4,6-dimethylpyrimidin-2-yl)amino]-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C24H27N9O2S/c1-16-15-17(2)28-21(27-16)30-23(33-13-11-32(12-14-33)22-25-9-4-10-26-22)31-24(36)29-19-7-5-18(6-8-19)20(34)35-3/h4-10,15H,11-14H2,1-3H3,(H2,27,28,29,30,31,36) |
| InChIKey | SLMYBPAVQMCYRL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|