C31H31N9S2 — CID 17078576
(3Z)-1-(4-anilinophenyl)-3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea (PubChem CID 17078576) has the molecular formula C31H31N9S2 and a molecular weight of 593.79 g/mol. Its IUPAC name is (3Z)-1-(4-anilinophenyl)-3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea.
| Compound Name | (3Z)-1-(4-anilinophenyl)-3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
|---|---|
| PubChem CID | 17078576 |
| Molecular Formula | C31H31N9S2 |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | (3Z)-1-(4-anilinophenyl)-3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2ccc(Nc3ccccc3)cc2)N2CCN(c3nsc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C31H31N9S2/c1-21-20-22(2)33-29(32-21)36-30(40-18-16-39(17-19-40)28-26-10-6-7-11-27(26)42-38-28)37-31(41)35-25-14-12-24(13-15-25)34-23-8-4-3-5-9-23/h3-15,20,34H,16-19H2,1-2H3,(H2,32,33,35,36,37,41) |
| InChIKey | MKRLZNNECXCOQC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|