C31H30N8OS2 — CID 17078575
(1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea (PubChem CID 17078575) has the molecular formula C31H30N8OS2 and a molecular weight of 594.77 g/mol. Its IUPAC name is (1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | (1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17078575 |
| Molecular Formula | C31H30N8OS2 |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | (1Z)-1-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]-3-(4-phenoxyphenyl)thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2ccc(Oc3ccccc3)cc2)N2CCN(c3nsc4ccccc34)CC2)n1 |
| InChI | InChI=1S/C31H30N8OS2/c1-21-20-22(2)33-29(32-21)35-30(39-18-16-38(17-19-39)28-26-10-6-7-11-27(26)42-37-28)36-31(41)34-23-12-14-25(15-13-23)40-24-8-4-3-5-9-24/h3-15,20H,16-19H2,1-2H3,(H2,32,33,34,35,36,41) |
| InChIKey | WEVYGECWSTUYDL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|