C26H30FN7S — CID 17090838
(3Z)-1-(3,5-dimethylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea (PubChem CID 17090838) has the molecular formula C26H30FN7S and a molecular weight of 491.64 g/mol. Its IUPAC name is (3Z)-1-(3,5-dimethylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea.
| Compound Name | (3Z)-1-(3,5-dimethylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 17090838 |
| Molecular Formula | C26H30FN7S |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (3Z)-1-(3,5-dimethylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C26H30FN7S/c1-17-13-18(2)15-22(14-17)30-26(35)32-25(31-24-28-19(3)16-20(4)29-24)34-11-9-33(10-12-34)23-7-5-21(27)6-8-23/h5-8,13-16H,9-12H2,1-4H3,(H2,28,29,30,31,32,35) |
| InChIKey | HVTIRWJAYLKCOD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|