C21H26FN7S — CID 21383432
(3Z)-1-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea (PubChem CID 21383432) has the molecular formula C21H26FN7S and a molecular weight of 427.55 g/mol. Its IUPAC name is (3Z)-1-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea.
| Compound Name | (3Z)-1-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 21383432 |
| Molecular Formula | C21H26FN7S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (3Z)-1-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)NC2CC2)N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C21H26FN7S/c1-14-13-15(2)24-19(23-14)26-20(27-21(30)25-17-5-6-17)29-11-9-28(10-12-29)18-7-3-16(22)4-8-18/h3-4,7-8,13,17H,5-6,9-12H2,1-2H3,(H2,23,24,25,26,27,30) |
| InChIKey | ZGPAVPMTVFMMDD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|