C24H25ClFN7S — CID 17090840
(3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea (PubChem CID 17090840) has the molecular formula C24H25ClFN7S and a molecular weight of 498.03 g/mol. Its IUPAC name is (3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea.
| Compound Name | (3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 17090840 |
| Molecular Formula | C24H25ClFN7S |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (3Z)-1-(2-chlorophenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)Nc2ccccc2Cl)N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C24H25ClFN7S/c1-16-15-17(2)28-22(27-16)30-23(31-24(34)29-21-6-4-3-5-20(21)25)33-13-11-32(12-14-33)19-9-7-18(26)8-10-19/h3-10,15H,11-14H2,1-2H3,(H2,27,28,29,30,31,34) |
| InChIKey | WZHNMMJAIKNNTF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|